A4315812
Fmoc-Asn(Trt)-OPfp , 96% , 132388-64-8
Synonym(s):
Fmoc-Asn(Trt)-OPfp;N-α-Fmoc-N-β-trityl-L-asparagine pentafluorophenyl ester
CAS NO.:132388-64-8
Empirical Formula: C44H31F5N2O5
Molecular Weight: 762.72
MDL number: MFCD00153373
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB71.20 | In Stock |
|
| 250mg | RMB95.20 | In Stock |
|
| 1G | RMB332.00 | In Stock |
|
| 5G | RMB1197.60 | In Stock |
|
| 25G | RMB3183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -7 º (C=1 IN DIOXANE) |
| Boiling point: | 888.2±65.0 °C(Predicted) |
| Density | 1.358±0.06 g/cm3(Predicted) |
| storage temp. | Store at -15°C to -25°C. |
| solubility | Soluble in water or 1% acetic acid |
| form | Powder |
| pka | 9.80±0.46(Predicted) |
| Major Application | peptide synthesis |
| InChIKey | YSONQVIVMGOLBG-UMSFTDKQSA-N |
| SMILES | Fc1c(c(c(c(c1F)F)OC(=O)[C@@H](NC(=O)OCC5c6c(cccc6)c7c5cccc7)CC(=O)NC(c4ccccc4)(c3ccccc3)c2ccccc2)F)F |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| WGK Germany | WGK 2 water endangering |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |



![(+)-Dehydroabietylamine [Optical Resolving Agent]](https://img.chemicalbook.com/CAS/GIF/1446-61-3.gif)

