A0305556
Dehydroabietylamine , >55.0%(GC)
Synonym(s):
1,4a-Dimethyl-7-isopropyl-1,2,3,4,4a,9,10,10a-octahydro-1-phenanthrenemethylamine
CAS NO.：
Empirical Formula: C20H31N
Molecular Weight: 285.47
MDL number: MFCD06795849
EINECS: 215-899-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB80.00 | In Stock |
|
| 500g | RMB440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44.50℃ |
| Boiling point: | 417.89°C (rough estimate) |
| Density | 0.963±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, DMSO, Methanol |
| form | White solid. |
| pka | 10.13±0.29(Predicted) |
| color | Pale Yellow |
| optical activity | [α]20/D +56.1°, c = 2.4 in pyridine |
| BRN | 3084620 |
| InChI | InChI=1S/C20H31N/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,13-21)10-5-11-20(17,18)4/h6,8,12,14,18H,5,7,9-11,13,21H2,1-4H3/t18-,19-,20+/m0/s1 |
| InChIKey | JVVXZOOGOGPDRZ-SLFFLAALSA-N |
| SMILES | [C@@]1(C)(CN)[C@@]2([H])[C@@](C)(C3=C(CC2)C=C(C(C)C)C=C3)CCC1 |
| CAS DataBase Reference | 1446-61-3(CAS DataBase Reference) |
| EPA Substance Registry System | Dehydroabietylamine (1446-61-3) |
Description and Uses
Dehydroabiethylamine is a primary amine with high molecular weight; shows a strong antibiotic effect with a broad spectrum of activity against Staphylococcus p.a. (sic), Escherichia coli, Mycobacterium tuberculosis, and Candida albicans.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | TP8701000 |
| F | 10-23 |
| HS Code | 29214990 |
| Hazardous Substances Data | 1446-61-3(Hazardous Substances Data) |
