A4317712
Fmoc-Met-OPfp , 96% , 86060-94-8
Synonym(s):
Fmoc-Met-OPfp;N-α-Fmoc-L-methionine pentafluorophenyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB147.20 | In Stock |
|
| 5G | RMB356.80 | In Stock |
|
| 25G | RMB1207.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-103℃ |
| Boiling point: | 650.6±55.0 °C(Predicted) |
| Density | 1.408±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 10.09±0.46(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | -11.6°(C=1.00g/100mL, CHCL3, 20°C, 589nm) |
| Major Application | peptide synthesis |
| InChIKey | OKDPSRDTLNXPFQ-SFHVURJKSA-N |
| SMILES | Fc1c(c(c(c(c1F)F)OC(=O)[C@@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)CCSC)F)F |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |







