A4318212
Fmoc-Thr(Bzl)-OH , 98% , 117872-75-0
Synonym(s):
Fmoc-O-benzyl-L -threonine
| Pack Size | Price | Stock | Quantity |
| 5G | RMB182.40 | In Stock |
|
| 25G | RMB604.00 | In Stock |
|
| 100g | RMB1864.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 643.7±55.0 °C(Predicted) |
| Density | 1.257±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.39±0.10(Predicted) |
| color | White |
| BRN | 6353662 |
| Major Application | peptide synthesis |
| InChIKey | UCDMMWCWPVCHLL-OSPHWJPCSA-N |
| SMILES | C[C@@H](OCc1ccccc1)[C@H](NC(=O)OCC2c3ccccc3-c4ccccc24)C(O)=O |
| CAS DataBase Reference | 117872-75-0(CAS DataBase Reference) |
Description and Uses
Fmoc-Thr(Bzl)-OH is a reagent used in the synthesis of thrombospondin-1 (TSR2) and associated peptide fragments.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 13 - Non Combustible Solids |







