A4319312
Fmoc-3-(1 naphthyl)-L-alanine , 98% , 96402-49-2
Synonym(s):
Fmoc-3-(1-naphthyl)-L -alanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB96.80 | In Stock |
|
| 5G | RMB308.80 | In Stock |
|
| 25G | RMB1084.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-183℃ |
| Boiling point: | 549.64°C (rough estimate) |
| Density | 1.2227 (rough estimate) |
| refractive index | 1.6290 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.77±0.30(Predicted) |
| color | White to off-white |
| BRN | 4829118 |
| Major Application | peptide synthesis |
| InChIKey | ORWNVJDLEMVDLV-SANMLTNESA-N |
| SMILES | OC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCC3c4ccccc4-c5ccccc35 |
| CAS DataBase Reference | 96402-49-2(CAS DataBase Reference) |
Description and Uses
Fmoc-1-Nal-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Warning |
| Hazard statements | H314 |
| Precautionary statements | P264b-P271-P280-P301+P330+P331-P304+P340-P305+P351+P338-P310-P363-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






