A4319612
Fmoc-β-(3-pyridyl)-D-Ala-OH , 98% , 142994-45-4
Synonym(s):
Fmoc-3-(3-pyridyl)-D -alanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB90.40 | In Stock |
|
| 1G | RMB234.40 | In Stock |
|
| 5G | RMB792.80 | In Stock |
|
| 25G | RMB3259.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166.5 °C |
| Boiling point: | 514.13°C (rough estimate) |
| Density | 1.2692 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | 2-8°C |
| solubility | Dichloromethane (Sparingly), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | 3.32±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 9223259 |
| InChI | InChI=1/C23H20N2O4/c26-22(27)21(12-15-6-5-11-24-13-15)25-23(28)29-14-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-11,13,20-21H,12,14H2,(H,25,28)(H,26,27)/t21-/s3 |
| InChIKey | JQLPMTXRCLXOJO-OAQYLSRUSA-N |
| SMILES | C1(COC(=O)N[C@@H](C(=O)O)CC2C=NC=CC=2)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| |
| CAS DataBase Reference | 142994-45-4(CAS DataBase Reference) |
Description and Uses
Fmoc-d-3-pyridylalanine, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
