A4320312
Fmoc-4-tert-butoxy-L-proline , 98% , 122996-47-8
Synonym(s):
Fmoc-O-tert-butyl-L -hydroxyproline;Fmoc-Hyp(tBu)-OH;N-α-Fmoc-O-t.-butyl-L-trans-4-hydroxyproline
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB172.00 | In Stock |
|
| 25g | RMB696.80 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~63 °C |
| Boiling point: | 578.6±50.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.71±0.40(Predicted) |
| form | Powder |
| color | White |
| optical activity | [α]20/D 25±2.5°, c = 1% in methanol |
| BRN | 6161467 |
| Major Application | peptide synthesis |
| InChIKey | WPBXBYOKQUEIDW-VFNWGFHPSA-N |
| SMILES | N1(C(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)C[C@H](OC(C)(C)C)C[C@H]1C(O)=O |
| CAS DataBase Reference | 122996-47-8(CAS DataBase Reference) |
Description and Uses
Fmoc-Hyp(tBu)-OH, is an amino acid derivative, used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2933 99 80 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |





