A4320812
4-Fluoro-D-phe-OH.HCl , 99% , 122839-52-5
CAS NO.：122839-52-5
Empirical Formula: C9H11ClFNO2
Molecular Weight: 219.64
MDL number: MFCD01321254
| Pack Size | Price | Stock | Quantity |
| 1G | RMB146.40 | In Stock |
|
| 5G | RMB483.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245 °C (dec.)(lit.) |
| alpha | 11 º (c=1, H2O) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| color | white |
| optical activity | [α]23/D +11°, c = 1 in H2O |
| Major Application | peptide synthesis |
| InChI | 1S/C9H10FNO2.ClH/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;/h1-4,8H,5,11H2,(H,12,13);1H/t8-;/m1./s1 |
| InChIKey | ZDECBCKSULAIGP-DDWIOCJRSA-N |
| SMILES | Cl.N[C@H](Cc1ccc(F)cc1)C(O)=O |
| CAS DataBase Reference | 122839-52-5(CAS DataBase Reference) |
Description and Uses
D-4-Fluorophenylalanine hydrochloride is mainly used as an amino acid derivative in medicine and biochemical research.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
