A5065212
<I>p</I>-Fluoro-<SC>D</SC>-phenylalanine , ≥98%(HPLC) , 18125-46-7
Synonym(s):
4-Fluoro-D -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB55.20 | In Stock |
|
| 5G | RMB208.80 | In Stock |
|
| 10g | RMB417.60 | In Stock |
|
| 25g | RMB683.20 | In Stock |
|
| 100g | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~245 °C (dec.) |
| Boiling point: | 313.3±32.0 °C(Predicted) |
| Density | 1.1939 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.20±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D +23±2°, c = 1% in H2O |
| BRN | 2416149 |
| InChI | InChI=1S/C9H10FNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | XWHHYOYVRVGJJY-MRVPVSSYSA-N |
| SMILES | C(O)(=O)[C@@H](CC1=CC=C(F)C=C1)N |
| CAS DataBase Reference | 18125-46-7(CAS DataBase Reference) |
Description and Uses
4-Fluoro-D-phenylalanine is a building block used in the preparation of new peptidomimetics.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 29224999 |
