A4321412
Fmoc-2-Abz-OH , 97% , 150256-42-1
Synonym(s):
N-Fmoc-anthranilic acid;2-(Fmoc-amino)benzoic acid
| Pack Size | Price | Stock | Quantity |
| 1g | RMB73.60 | In Stock |
|
| 5G | RMB166.40 | In Stock |
|
| 25G | RMB488.00 | In Stock |
|
| 100g | RMB1772.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-218 °C(lit.) |
| Boiling point: | 537.6±33.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Dimethylformamide |
| pka | 3.60±0.36(Predicted) |
| form | Powder |
| color | White to off-white |
| Water Solubility | Soluble in water or 1% acetic acid. |
| BRN | 7659726 |
| Major Application | peptide synthesis |
| InChI | 1S/C22H17NO4/c24-21(25)18-11-5-6-12-20(18)23-22(26)27-13-19-16-9-3-1-7-14(16)15-8-2-4-10-17(15)19/h1-12,19H,13H2,(H,23,26)(H,24,25) |
| InChIKey | CNAVPEPPAVHHKN-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccccc1NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 150256-42-1(CAS DataBase Reference) |
Description and Uses
It is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






