A4321912
Fmoc-N-Me-Ala-OH , 97% , 84000-07-7
Synonym(s):
Fmoc-N-methyl-L -alanine;Fmoc-N-Me-Ala-OH;N-α-Fmoc-N-α-methyl-L-alanine
CAS NO.：84000-07-7
Empirical Formula: C19H19NO4
Molecular Weight: 325.36
MDL number: MFCD00153384
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.84 | In Stock |
|
| 5G | RMB87.20 | In Stock |
|
| 25G | RMB324.80 | In Stock |
|
| 100G | RMB1404.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~150 °C |
| alpha | -18.5 º (c=1,DMF) |
| Boiling point: | 514.9±29.0 °C(Predicted) |
| Density | 1.262±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Dimethylformamide[soluble in] |
| solubility | Soluble in water or 1% acetic acid |
| pka | 3.92±0.10(Predicted) |
| form | Solid |
| color | White to Almost white |
| optical activity | [α]20/D 18.5±1°, c = 1% in DMF |
| Water Solubility | Slightly soluble in water. |
| BRN | 4329998 |
| Sequence | Fmoc-N-Me-Ala-OH |
| Major Application | peptide synthesis |
| InChI | 1S/C19H19NO4/c1-12(18(21)22)20(2)19(23)24-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12,17H,11H2,1-2H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | JOFHWKQIQLPZTC-LBPRGKRZSA-N |
| SMILES | C[C@H](N(C)C(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| CAS DataBase Reference | 84000-07-7(CAS DataBase Reference) |
Description and Uses
It is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. Also used in N-methyl amino acids for peptide synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
