A4322212
Fmoc-N-methyl-L-isoleucine , 98% , 138775-22-1
Synonym(s):
Fmoc-N-methyl-L -isoleucine;Fmoc-N-Me-Ile-OH;N-α-Fmoc-N-α-methyl-L-isoleucine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB65.60 | In Stock |
|
| 5G | RMB193.60 | In Stock |
|
| 25G | RMB772.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-183 °C |
| Boiling point: | 537.3±29.0 °C(Predicted) |
| Density | 1.194±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Solid |
| pka | 3.94±0.22(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 59±2°, c = 1% in DMF |
| BRN | 7548444 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C22H25NO4/c1-4-14(2)20(21(24)25)23(3)22(26)27-13-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,14,19-20H,4,13H2,1-3H3,(H,24,25)/t14-,20-/m0/s1 |
| InChIKey | IQIOLCJHRZWOLS-XOBRGWDASA-N |
| SMILES | C(O)(=O)[C@H]([C@@H](C)CC)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C |
| CAS DataBase Reference | 138775-22-1(CAS DataBase Reference) |
Description and Uses
Fmoc-N-Me-Ile-OH is a useful intermediate used in the total synthesis of Nannocystin A, a 21-membered cyclodepsipeptide with anticancer properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |







