BD8281847
Fmoc-N-Me-Thr(Bzl)-OH , 98% , 198561-81-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB208.00 | In Stock |
|
| 5g | RMB728.80 | In Stock |
|
| 10g | RMB1313.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-122 °C |
| Boiling point: | 622.0±55.0 °C(Predicted) |
| Density | 1.244±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.41±0.10(Predicted) |
| form | Solid |
| color | Off-white to light yellow |
| optical activity | Consistent with structure |
| Major Application | peptide synthesis |
| InChIKey | OJELSPMZRJEODW-CJAUYULYSA-N |
| SMILES | C[C@@H](OCc1ccccc1)[C@H](N(C)C(=O)OCC2c3ccccc3-c4ccccc24)C(O)=O |
| CAS DataBase Reference | 198561-81-8 |
Description and Uses
peptide synthesis
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
