A5447412
Fmoc-N-Methyl-D-leucine , 97% , 103478-63-3
Synonym(s):
Fmoc-N-methyl-D -leucine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB134.40 | In Stock |
|
| 5G | RMB543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-116 °C |
| Boiling point: | 537.3±29.0 °C(Predicted) |
| Density | 1.194±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in clear solution (0.3 gram in 2 ml DMF). |
| form | Powder |
| pka | 3.93±0.21(Predicted) |
| color | Off-white |
| BRN | 7350417 |
| Major Application | peptide synthesis |
| InChI | 1S/C22H25NO4/c1-14(2)12-20(21(24)25)23(3)22(26)27-13-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,14,19-20H,12-13H2,1-3H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | BUJQSIPFDWLNDC-HXUWFJFHSA-N |
| SMILES | CC(C)C[C@@H](N(C)C(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| CAS DataBase Reference | 103478-63-3(CAS DataBase Reference) |
Description and Uses
Tripeptides were prepared by means of coupling of N-Fmoc-N-methyl-D-leucine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |
