Fmoc-6-aminohexanoic acid , 98% , 88574-06-5
Synonym(s):
6-(Fmoc-amino)caproic acid;6-(Fmoc-amino)hexanoic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB44.80 | In Stock |
|
| 25G | RMB120.00 | In Stock |
|
| 100g | RMB455.20 | In Stock |
|
| 500g | RMB2079.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 114 °C |
| Boiling point: | 582.7±33.0 °C(Predicted) |
| Density | 1.210±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| pka | 4.75±0.10(Predicted) |
| form | Powder |
| color | White |
| Water Solubility | Soluble in 1% acetic acid, water and 1mmol in 2mL DMF clearly soluble. |
| BRN | 5883220 |
| Major Application | peptide synthesis |
| InChI | 1S/C21H23NO4/c23-20(24)12-2-1-7-13-22-21(25)26-14-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)19/h3-6,8-11,19H,1-2,7,12-14H2,(H,22,25)(H,23,24) |
| InChIKey | FPCPONSZWYDXRD-UHFFFAOYSA-N |
| SMILES | OC(=O)CCCCCNC(=O)OCC1c2ccccc2-c3ccccc13 |
| CAS DataBase Reference | 88574-06-5(CAS DataBase Reference) |
Description and Uses
Fmoc-6-aminohexanoic acid can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applications. Fmoc-6-aminohexanoic acid is an alkane chian with terminal Fmoc-protected amine and carboxylic acid groups. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond.
Fmoc-6-aminohexanoic acid, is an amino acid derivative used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |







