A4329412
4-Fluoro-3-methoxybenzeneboronic acid , 98% , 854778-31-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB28.00 | In Stock |
|
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB241.60 | In Stock |
|
| 25g | RMB1025.60 | In Stock |
|
| 100g | RMB3750.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-191 |
| Boiling point: | 318.1±52.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.19±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H8BFO3/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,10-11H,1H3 |
| InChIKey | LUJMSRVFSBMEOY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(F)C(OC)=C1)(O)O |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |






