A4331012
3-Fluoro-4-methylbenzonitrile , 98% , 170572-49-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB109.60 | In Stock |
|
| 100G | RMB367.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-51 °C |
| Boiling point: | 204°C |
| Density | 1.11±0.1 g/cm3(Predicted) |
| Flash point: | 182 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 7700177 |
| InChI | InChI=1S/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| InChIKey | KUQQONVKIURIQU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C)C(F)=C1 |
| CAS DataBase Reference | 170572-49-3(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-methylbenzonitrile is a nitrile derivative that can be used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
