A4331712
4-Fluoro-2-nitroaniline , 98% , 364-78-3
CAS NO.:364-78-3
Empirical Formula: C6H5FN2O2
Molecular Weight: 156.11
MDL number: MFCD00007830
EINECS: 206-666-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB88.00 | In Stock |
|
| 100G | RMB302.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-94 °C (lit.) |
| Boiling point: | 295.1±20.0 °C(Predicted) |
| Density | 1.3822 (estimate) |
| Flash point: | 193 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | -0.11±0.10(Predicted) |
| color | Orange to brown |
| Water Solubility | INSOLUBLE |
| BRN | 2210197 |
| InChI | InChI=1S/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| InChIKey | PUGDHSSOXPHLPT-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 364-78-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-2-nitroaniline(364-78-3) |
Description and Uses
4-Fluoro-2-nitroaniline is used as a reagent in the preparation of 4-fluoro-o-phenylenediamine, 4-fluoro-N-ethyl-2-nitroaniline and N-(4-fluoro-2-nitrophenyl)-beta-alanine. It is also employed as a pharmaceutical intermediate. It acts as monodendate O-bonded ligand used in the coordination chemistry to form complexes with copper(II), nickel(II) and cobalt(II).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







