A4334912
3-Fluoro-4-nitrotoluene , 99% , 446-34-4
CAS NO.:446-34-4
Empirical Formula: C7H6FNO2
Molecular Weight: 155.13
MDL number: MFCD00007053
EINECS: 207-166-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB82.40 | In Stock |
|
| 100G | RMB300.00 | In Stock |
|
| 500g | RMB1391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-55 °C (lit.) |
| Boiling point: | 97-98 °C/3 mmHg (lit.) |
| Density | 1,438 g/cm3 |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Insoluble[in water] |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 2502584 |
| InChI | InChI=1S/C7H6FNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| InChIKey | WZMOWQCNPFDWPA-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(C)C=C1F |
| CAS DataBase Reference | 446-34-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Fluoro-4-nitrotoluene(446-34-4) |
| EPA Substance Registry System | 3-Fluoro-4-nitrotoluene (446-34-4) |
Description and Uses
3-Fluoro-4-nitrotoluene has been used in the preparation of IκB kinase (IKK) inhibitor, BMS [N1-(1,8-dimethylimidazo[1,2-a]quinolin-4-yl)-ethane-1,2-diamine].
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H302-H312-H331 |
| Precautionary statements | P304+P340-P405-P501a-P261-P280-P305+P351+P338-P264-P270-P271-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37-45-37-28A-24/25 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





