A4335512
3-Fluoro-2-methylaniline , 99% , 443-86-7
Synonym(s):
3-Fluoro-o-toluidine
CAS NO.:443-86-7
Empirical Formula: C7H8FN
Molecular Weight: 125.14
MDL number: MFCD00007760
EINECS: 207-142-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB138.40 | In Stock |
|
| 100G | RMB469.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7 °C (lit.) |
| Boiling point: | 89-91 °C/15 mmHg (lit.) |
| Density | 1.099 g/mL at 25 °C (lit.) |
| refractive index | 1.542-1.544 |
| Flash point: | 86 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Methanol (Slightly) |
| form | Oil |
| pka | 3.44±0.10(Predicted) |
| Specific Gravity | 1.099 |
| color | Pale Yellow to Dark Red |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C7H8FN/c1-5-6(8)3-2-4-7(5)9/h2-4H,9H2,1H3 |
| InChIKey | SLDLVGFPFFLYBM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(F)=C1C |
| CAS DataBase Reference | 443-86-7(CAS DataBase Reference) |
Description and Uses
3-Fluoro-2-methylaniline was used in the synthesis of 2-amino-1,7,9-trimethylimidazo[4,5-g]quinoxaline.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 36/37/38-23/24/25-20/21/22 |
| Safety Statements | 45-36/37/39-26-36/37-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |





