A4336112
5-Fluoro-2-methylaniline , 98% , 367-29-3
Synonym(s):
2-Amino-4-fluorotoluene;5-Fluoro-o-toluidine
CAS NO.:367-29-3
Empirical Formula: C7H8FN
Molecular Weight: 125.14
MDL number: MFCD00007764
EINECS: 206-689-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10g | RMB35.20 | In Stock |
|
| 50g | RMB79.20 | In Stock |
|
| 25G | RMB91.20 | In Stock |
|
| 100G | RMB253.60 | In Stock |
|
| 500g | RMB1143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-40 °C (lit.) |
| Boiling point: | 98-100°C 15mm |
| Density | 1.13 g/cm3 (20℃) |
| refractive index | 1.538 |
| Flash point: | 194 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | Crystalline Solid or Liquid |
| pka | 3.44±0.10(Predicted) |
| color | Purple to brown |
| Water Solubility | insoluble |
| BRN | 2637584 |
| InChI | InChI=1S/C7H8FN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3 |
| InChIKey | JLCDTNNLXUMYFQ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=CC=C1C |
| CAS DataBase Reference | 367-29-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Fluoro-2-methylaniline(367-29-3) |
Description and Uses
Used as a pharmaceutical intermediate in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS06,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H302-H311-H332-H373 |
| Precautionary statements | P261-P280-P301+P312+P330-P305+P351+P338-P260-P304+P340-P405-P501a-P264-P270-P271-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38-23/24/25 |
| Safety Statements | 26-27-36/37/39-45-36 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







