A4336512
Flavoxate hydrochloride , 98% , 3717-88-2
Synonym(s):
3-Methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylic acid 2-(1-piperidinyl)ethyl ester hydrochloride;DW-61;Rec-7-0040
CAS NO.:3717-88-2
Empirical Formula: C24H26ClNO4
Molecular Weight: 427.92
MDL number: MFCD00072099
EINECS: 223-066-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB88.80 | In Stock |
|
| 25G | RMB257.60 | In Stock |
|
| 100g | RMB605.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232-234°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: ~6.6 mg/mL |
| form | solid |
| color | white |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C24H25NO4.ClH/c1-17-21(26)19-11-8-12-20(23(19)29-22(17)18-9-4-2-5-10-18)24(27)28-16-15-25-13-6-3-7-14-25;/h2,4-5,8-12H,3,6-7,13-16H2,1H3;1H |
| InChIKey | XOEVKNFZUQEERE-UHFFFAOYSA-N |
| SMILES | C12OC(=C(C)C(=O)C=1C=CC=C2C(=O)OCCN1CCCCC1)C1C=CC=CC=1.Cl |
| CAS DataBase Reference | 3717-88-2(CAS DataBase Reference) |
Description and Uses
Smooth muscle relaxant. Used as antispasmodic; in treatment of urinary incontinence.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H335 |
| Precautionary statements | P301+P312+P330 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | DJ2450000 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral STOT SE 3 |
| Toxicity | LD50 i.v. in rats: 27.4 mg/kg (Cazzulani) |





