PRODUCT Properties
| Melting point: | 37-38 °C (lit.) |
| Boiling point: | 87 °C/14 mmHg (lit.) |
| Density | 1.1514 (estimate) |
| refractive index | 1.5155-1.5175 |
| Flash point: | 185 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 10.32±0.18(Predicted) |
| form | Low Melting Solid or Liquid |
| color | Off-white to brownish |
| Water Solubility | Insoluble in water. |
| BRN | 2041490 |
| InChI | InChI=1S/C7H7FO/c1-5-4-6(8)2-3-7(5)9/h2-4,9H,1H3 |
| InChIKey | GKQDDKKGDIVDAG-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C=C1C |
| CAS DataBase Reference | 452-72-2(CAS DataBase Reference) |
Description and Uses
4-Fluoro-2-methylphenol is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-21/22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HS Code | 29081990 |
