A4337112
4-Fluoro-3-methylphenol , 98% , 452-70-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB160.00 | In Stock |
|
| 100G | RMB540.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32 °C (lit.) |
| Boiling point: | 76 °C/5 mmHg (lit.) |
| Density | 1.134 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 206 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| pka | 10.09±0.18(Predicted) |
| Specific Gravity | 1.134 |
| color | Clear colorless to pale yellow |
| InChI | InChI=1S/C7H7FO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| InChIKey | RVYGYYVGWSCWGY-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C(C)=C1 |
| CAS DataBase Reference | 452-70-0(CAS DataBase Reference) |
Description and Uses
4-Fluoro-3-methylphenol was used to detect the aromatic metabolites in methanogenic m-cresol-degrading consortium. It was also used in the preparation of 8-fluoronaphthoquinone via Friedel Crafts acylation reaction with maleic anhydride.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HS Code | 29081990 |
