A4337412
2-Fluoro-6-iodobenzonitrile , 98% , 79544-29-9
CAS NO.：79544-29-9
Empirical Formula: C7H3FIN
Molecular Weight: 247.01
MDL number: MFCD00015478
EINECS: 279-200-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB206.40 | In Stock |
|
| 100G | RMB623.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-53 °C (lit.) |
| Boiling point: | 271.3±25.0 °C(Predicted) |
| Density | 1.98±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystals or Crystalline Powder |
| color | White |
| Sensitive | Light Sensitive |
| BRN | 4971873 |
| InChI | InChI=1S/C7H3FIN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| InChIKey | FAACTMVXBNSPJA-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(I)C=CC=C1F |
| CAS DataBase Reference | 79544-29-9(CAS DataBase Reference) |
Description and Uses
2-Fluoro-6-iodobenzonitrile, is an aryl fluorinated building block used in the chemical synthesis of various compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,T,Xi,F |
| Risk Statements | 20/21/22-36/37/38-15-10 |
| Safety Statements | 36/37-43-36-26-7/8 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
