A4341512
2-Fluorobenzophenone , 98% , 342-24-5
CAS NO.：342-24-5
Empirical Formula: C13H9FO
Molecular Weight: 200.21
MDL number: MFCD00000318
EINECS: 206-440-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100G | RMB655.20 | In Stock |
|
| 500g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 190 °C (29 mmHg) |
| Density | 1.18 |
| refractive index | 1.584-1.587 |
| Flash point: | >110°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.186 |
| BRN | 2047045 |
| InChI | InChI=1S/C13H9FO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9H |
| InChIKey | DWFDQVMFSLLMPE-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1F)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 342-24-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Fluorobenzophenone (342-24-5) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36/37/39-27-37 |
| HazardClass | IRRITANT |
| HS Code | 29143990 |
