A4407712
2-Fluorobenzoic Acid , >98.0% , 445-29-4
CAS NO.:445-29-4
Empirical Formula: C7H5FO2
Molecular Weight: 140.11
MDL number: MFCD00002405
EINECS: 207-158-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB44.80 | In Stock |
|
| 250G | RMB150.40 | In Stock |
|
| 500G | RMB191.20 | In Stock |
|
| 2.5kg | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-125 °C (lit.) |
| Boiling point: | 114 °C |
| Density | 1,46 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 7.2g/l |
| form | Crystalline Powder or Needles |
| pka | 3.27(at 25℃) |
| color | White to light yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 971265 |
| InChI | InChI=1S/C7H5FO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | NSTREUWFTAOOKS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1F |
| CAS DataBase Reference | 445-29-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2-fluoro-(445-29-4) |
| EPA Substance Registry System | Benzoic acid, 2-fluoro- (445-29-4) |
Description and Uses
2-Fluorobenzoic acid may be employed in the preparation of zaragozic acid A analogs. It is also used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-36/37/38 |
| Safety Statements | 22-26-28-24/25-37/39-36 |
| WGK Germany | 3 |
| RTECS | DH0250000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |







