Fmoc-GABA-OH , ≥97.0%(HPLC) , 116821-47-7
                            Synonym(s):
4-(Fmoc-amino)butyric acid;Fmoc-GABA
                            
                        
                CAS NO.:116821-47-7
Empirical Formula: C19H19NO4
Molecular Weight: 325.36
MDL number: MFCD00144889
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB28.00 | In Stock | 
                                                 | 
                                        
| 5G | RMB40.00 | In Stock | 
                                                 | 
                                        
| 25G | RMB69.60 | In Stock | 
                                                 | 
                                        
| 100G | RMB268.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
PRODUCT Properties
| Melting point: | 172.0 to 176.0 °C | 
                                    
| Boiling point: | 571.9±33.0 °C(Predicted) | 
                                    
| Density | 1.256±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | 2-8°C | 
                                    
| pka | 4.68±0.10(Predicted) | 
                                    
| form | Powder | 
                                    
| color | White | 
                                    
| Water Solubility | Slightly soluble in water. | 
                                    
| BRN | 7491485 | 
                                    
| InChI | InChI=1S/C19H19NO4/c21-18(22)10-5-11-20-19(23)24-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17H,5,10-12H2,(H,20,23)(H,21,22) | 
                                    
| InChIKey | ACUIFAAXWDLLTR-UHFFFAOYSA-N | 
                                    
| SMILES | C(O)(=O)CCCNC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | 
                                    
| CAS DataBase Reference | 116821-47-7(CAS DataBase Reference) | 
                                    
Description and Uses
Fmoc-4-aminobutanoic acid can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applications. Fmoc-4-aminobutanoic acid is an alkane chian with terminal Fmoc-protected amine and carboxylic acid groups. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond.
4-(Fmoc-amino)butyric acid is used in agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H335-H319-H315 | 
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P | 
| Safety Statements | 22-24/25 | 
| WGK Germany | 3 | 
| HS Code | 2924 29 70 | 
| HazardClass | IRRITANT | 







