A4345912
2-Fluoro-5-nitroaniline , 98% , 369-36-8
CAS NO.:369-36-8
Empirical Formula: C6H5FN2O2
Molecular Weight: 156.11
MDL number: MFCD00007652
EINECS: 206-720-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB77.60 | In Stock |
|
| 100G | RMB301.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-100 °C (lit.) |
| Boiling point: | 295.5±20.0 °C(Predicted) |
| Density | 1.3822 (estimate) |
| Flash point: | 196 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 1.13±0.10(Predicted) |
| color | Ochre-yellow to light brown |
| Water Solubility | Slightly soluble |
| BRN | 2803491 |
| InChI | InChI=1S/C6H5FN2O2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H,8H2 |
| InChIKey | KJVBJICWGQIMOZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC([N+]([O-])=O)=CC=C1F |
| CAS DataBase Reference | 369-36-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Fluoro-5-nitroaniline(369-36-8) |
| EPA Substance Registry System | Benzenamine, 2-fluoro-5-nitro- (369-36-8) |
Description and Uses
It is employed as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







