A4349312
2-Fluoro-5-(trifluoromethyl)benzylamine , 97% , 199296-61-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB154.08 | In Stock |
|
| 5G | RMB568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 175.9±35.0 °C(Predicted) |
| Density | 1.312±0.06 g/cm3(Predicted) |
| refractive index | 1.451 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 8.27±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C8H7F4N/c9-7-2-1-6(8(10,11)12)3-5(7)4-13/h1-3H,4,13H2 |
| InChIKey | WIQWADYBGSRGCF-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC(C(F)(F)F)=CC=C1F |
| CAS DataBase Reference | 199296-61-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Fluoro-5-(trifluoromethyl)benzylamine(199296-61-2) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C,Xi,T |
| Risk Statements | 34-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 2735 |
| Hazard Note | Corrosive/Store under nitrogen |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2921490090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
