A4349912
4-Fluoro-2-iodotoluene , 98% , 13194-67-7
CAS NO.:13194-67-7
Empirical Formula: C7H6FI
Molecular Weight: 236.03
MDL number: MFCD00013709
EINECS: 236-153-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB212.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 92-94 °C15 mm Hg(lit.) |
| Density | 1.752 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 188 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Orange to Green |
| Sensitive | Light Sensitive |
| BRN | 2242594 |
| InChI | InChI=1S/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey | RZGYAMQMAVTAKP-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(F)C=C1I |
| CAS DataBase Reference | 13194-67-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,Xi |
| Risk Statements | 25-52/53-36/37/38 |
| Safety Statements | 45-37/39-26 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |






