A4350712
2-Fluoro-6-(trifluoromethyl)benzyl bromide , 98% , 239087-08-2
CAS NO.:239087-08-2
Empirical Formula: C8H5BrF4
Molecular Weight: 257.02
MDL number: MFCD00082477
EINECS: 627-330-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB130.40 | In Stock |
|
| 5G | RMB484.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-42 °C (lit.) |
| Boiling point: | 186℃ |
| Density | 1.640 |
| Flash point: | 225 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Lachrymatory |
| InChI | InChI=1S/C8H5BrF4/c9-4-5-6(8(11,12)13)2-1-3-7(5)10/h1-3H,4H2 |
| InChIKey | RINUERVPFANASB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(C(F)(F)F)=C1CBr |
| CAS DataBase Reference | 239087-08-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39 |
| RIDADR | UN 1759 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






