A4351312
3-Fluoro-4-(trifluoromethyl)phenylacetic acid , 97% , 238754-67-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB324.00 | In Stock |
|
| 5G | RMB1000.80 | In Stock |
|
| 25g | RMB4856.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-90°C |
| Boiling point: | 266.6±35.0 °C(Predicted) |
| Density | 1.436±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | crystalline powder |
| pka | 3.81±0.10(Predicted) |
| color | White to off white |
| InChI | InChI=1S/C9H6F4O2/c10-7-3-5(4-8(14)15)1-2-6(7)9(11,12)13/h1-3H,4H2,(H,14,15) |
| InChIKey | ZFOWDXKJQNNLMW-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(C(F)(F)F)C(F)=C1 |
| CAS DataBase Reference | 238754-67-1(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-(trifluoromethyl)phenylacetic acid is a fluorinated phenylacetic acid analogue that can be used in the preparation of medicinal chemicals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
