A4351612
4-Fluorophthalic anhydride , 98% , 319-03-9
CAS NO.:319-03-9
Empirical Formula: C8H3FO3
Molecular Weight: 166.11
MDL number: MFCD00191363
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB119.20 | In Stock |
|
| 5G | RMB479.20 | In Stock |
|
| 25G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-79 °C (lit.) |
| Boiling point: | 148°C 20mm |
| Density | 1.55 |
| Flash point: | >93°C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in sodium hydroxide. |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 131281 |
| InChI | InChI=1S/C8H3FO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H |
| InChIKey | XVMKZAAFVWXIII-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(F)C=C2)C(=O)O1 |
| CAS DataBase Reference | 319-03-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Isobenzofurandione, 5-fluoro- (319-03-9) |
Description and Uses
4-Fluorophthalic anhydride is used in the preparation of 5-fluoro-2-pyridin-3-ylmethyl-isoindole-1,3-dione by reacting with C-pyridin-3-yl-methylamine.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-42/43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | IRRITANT, MOISTURE SENSITIVE |
| PackingGroup | Ⅲ |
| HS Code | 29173990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





