A6266312
3-Nitrophthalic Anhydride , >97.0% , 641-70-3
Synonym(s):
3-Nitrophthalic acid anhydride;3-Nitrophthalic anhydride;4-Nitro-2-benzofuran-1,3-dione;4-Nitroisobenzofuran-1,3-dione
CAS NO.:641-70-3
Empirical Formula: C8H3NO5
Molecular Weight: 193.11
MDL number: MFCD00005921
EINECS: 211-373-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB47.20 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB155.20 | In Stock |
|
| 500G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-165 °C (lit.) |
| Boiling point: | 329.3°C (rough estimate) |
| Density | 1.6392 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | Store below +30°C. |
| form | Crystalline Powder |
| color | Beige to yellow |
| Water Solubility | MAY DECOMPOSE |
| Sensitive | Moisture Sensitive |
| BRN | 179963 |
| InChI | InChI=1S/C8H3NO5/c10-7-4-2-1-3-5(9(12)13)6(4)8(11)14-7/h1-3H |
| InChIKey | ROFZMKDROVBLNY-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C([N+]([O-])=O)=CC=C2)C(=O)O1 |
| CAS DataBase Reference | 641-70-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Nitrophthalic anhydride(641-70-3) |
| EPA Substance Registry System | 1,3-Isobenzofurandione, 4-nitro- (641-70-3) |
Description and Uses
An intermediate for the synthesis of a benzimidazole PARP inhibitor I (succinate salt) (ABT-472). Reactions with aminoquinazolinones yield phthalimidoquinazolinones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






