PRODUCT Properties
| Melting point: | 38-40 °C (lit.) |
| Boiling point: | 113-114 °C (lit.) |
| Density | 1.216 g/mL at 25 °C (lit.) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Low Melting Solid |
| Specific Gravity | 1.216 |
| color | White to yellow |
| Water Solubility | insoluble |
| BRN | 1617799 |
| InChI | InChI=1S/C9H7FO/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5H,1,4H2 |
| InChIKey | WVPPBVAMKNQXJA-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(F)C=C2)CC1 |
| CAS DataBase Reference | 700-84-5(CAS DataBase Reference) |
Description and Uses
5-Fluoro-1-indanone was used to prepare precursor for thiosemicarbazones derived from 1-indanones. It was used in the synthesis of 6-fluoro-1,2,3,4-tetrahydroquinoline hydrochloride.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






