A4355112
3-Fluoro-4-pyridineboronic acid pinacol ester , 97% , 458532-88-2
Synonym(s):
3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxoborolan-2-yl)pyridine
CAS NO.:458532-88-2
Empirical Formula: C11H15BFNO2
Molecular Weight: 223.05
MDL number: MFCD06798251
| Pack Size | Price | Stock | Quantity |
| 1G | RMB140.80 | In Stock |
|
| 5g | RMB525.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-127°C |
| Boiling point: | 292.4±25.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 1.97±0.20(Predicted) |
| form | solid |
| color | White to off-white |
| InChI | InChI=1S/C11H15BFNO2/c1-10(2)11(3,4)16-12(15-10)8-5-6-14-7-9(8)13/h5-7H,1-4H3 |
| InChIKey | MLFGHAHGSVFKMI-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(B2OC(C)(C)C(C)(C)O2)=C1F |
| CAS DataBase Reference | 458532-88-2(CAS DataBase Reference) |
Description and Uses
3-Fluoropyridine-4-boronic acid, pinacol ester
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






