A4357912
2-Fluoro-5-methylphenol , 98% , 63762-79-8
Synonym(s):
6-Fluoro-m-cresol
CAS NO.:63762-79-8
Empirical Formula: C7H7FO
Molecular Weight: 126.13
MDL number: MFCD00190101
EINECS: 264-514-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB58.40 | In Stock |
|
| 5G | RMB220.80 | In Stock |
|
| 10g | RMB346.40 | In Stock |
|
| 25G | RMB762.48 | In Stock |
|
| 100g | RMB1710.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32 °C |
| Boiling point: | 173 °C(lit.) |
| Density | 1.155 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 153 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 8.82±0.10(Predicted) |
| form | liquid |
| color | Clear, colourless |
| Specific Gravity | 1.155 |
| BRN | 2433017 |
| InChI | InChI=1S/C7H7FO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
| InChIKey | XEHPMVZYZDQLDN-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(C)=CC=C1F |
| CAS DataBase Reference | 63762-79-8(CAS DataBase Reference) |
Description and Uses
2-Fluoro-5-methylphenol may be employed as additive in various alkyne metatheses.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H227-H302-H312-H314-H318-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280-P309-P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-21/22 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | 2922 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HS Code | 29081990 |






