A4358012
3-Fluoro-4-methylphenol , >98.0%(GC) , 452-78-8
CAS NO.:452-78-8
Empirical Formula: C7H7FO
Molecular Weight: 126.13
MDL number: MFCD00143164
EINECS: 200-110-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB97.60 | In Stock |
|
| 25g | RMB324.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72 °C |
| Boiling point: | 196 °C |
| Density | 1.17 |
| refractive index | 1.5150 |
| Flash point: | 29 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to lump |
| pka | 9.27±0.18(Predicted) |
| color | White to Light yellow to Light orange |
| Odor | Phenol-like |
| InChI | InChI=1S/C7H7FO/c1-5-2-3-6(9)4-7(5)8/h2-4,9H,1H3 |
| InChIKey | GJOOCAXPERKNMN-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C)C(F)=C1 |
| CAS DataBase Reference | 452-78-8(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-methylphenol is a phenolic derivative and can be used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H227-H302-H312-H314-H318 |
| Precautionary statements | P305+P351+P338-P309-P310-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 21/22-34-52-36-22 |
| Safety Statements | 26-36/37/39-60-45 |
| RIDADR | 2922 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 |







![2,2',3,3',5,5',6,6'-Octafluoro-[1,1'-biphenyl]-4,4'-diol](https://img.chemicalbook.com/CAS/GIF/2200-70-6.gif)
