A4357612
2'-Fluoro-4'-hydroxyacetophenone , 98%(GC) , 98619-07-9
CAS NO.：98619-07-9
Empirical Formula: C8H7FO2
Molecular Weight: 154.14
MDL number: MFCD00142713
EINECS: 619-366-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.80 | In Stock |
|
| 5G | RMB130.40 | In Stock |
|
| 25G | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-124 °C |
| Boiling point: | 203.5°C (rough estimate) |
| Density | 1.1850 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 7.17±0.18(Predicted) |
| form | powder |
| color | Cream |
| Water Solubility | insoluble |
| BRN | 696642 |
| InChI | InChI=1S/C8H7FO2/c1-5(10)7-3-2-6(11)4-8(7)9/h2-4,11H,1H3 |
| InChIKey | ZCZIRBNZMFUCOH-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(O)C=C1F)C |
| CAS DataBase Reference | 98619-07-9(CAS DataBase Reference) |
Description and Uses
2'-Fluoro-4'-hydroxyacetophenone is used in used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22-52 |
| Safety Statements | 37/39-26-24/25 |
| HazardClass | IRRITANT |
| HS Code | 29143990 |
