A3612312
3',5'-Dihydroxyacetophenone , >98.0%(GC) , 51863-60-6
CAS NO.:51863-60-6
Empirical Formula: C8H8O3
Molecular Weight: 152.15
MDL number: MFCD06656033
EINECS: 257-480-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB32.00 | In Stock |
|
| 10G | RMB60.80 | In Stock |
|
| 50G | RMB239.20 | In Stock |
|
| 250g | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-146 °C(lit.) |
| Boiling point: | 234.6°C (rough estimate) |
| Density | 1.2143 (rough estimate) |
| refractive index | 1.4447 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 8.63±0.10(Predicted) |
| form | Powder |
| color | Off-white to brown |
| BRN | 1936502 |
| InChI | InChI=1S/C8H8O3/c1-5(9)6-2-7(10)4-8(11)3-6/h2-4,10-11H,1H3 |
| InChIKey | WQXWIKCZNIGMAP-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(O)=CC(O)=C1)C |
| LogP | 1.019 (est) |
| CAS DataBase Reference | 51863-60-6(CAS DataBase Reference) |
Description and Uses
3'',5''-Dihydroxyacetophenone is a dihydroxy derivative of acetophenone. 3'',5''-Dihydroxyacetophenone shows inhibitory activity towards plant germination and growth as well as some antitumor activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






