A4364712
Fluocinolone Acetonide , ≥98% , 67-73-2
Synonym(s):
Fluocinolone acetonide;Sinalar;Synandone;6α,9α-Difluoro-11β,16α,17α,21-tetrahydroxy-1,4-pregnadiene-3,20-dione;6α,9α-Difluoro-16α-hydroxyprednisolone 16,17-acetonide
CAS NO.:67-73-2
Empirical Formula: C24H30F2O6
Molecular Weight: 452.49
MDL number: MFCD00010525
EINECS: 200-668-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB239.20 | In Stock |
|
| 1G | RMB382.40 | In Stock |
|
| 5G | RMB2399.20 | In Stock |
|
| 25g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 267-269 °C(lit.) |
| alpha | D +95° (chloroform) |
| Boiling point: | 578.5±50.0 °C(Predicted) |
| Density | 1.1826 (estimate) |
| refractive index | 103 ° (C=1, MeOH) |
| storage temp. | Refrigerator |
| solubility | Practically insoluble in water, soluble in acetone and in ethanol |
| pka | 12.78±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water (partly), DMSO, alcohol, chloroform and methanol. |
| Merck | 14,4150 |
| Major Application | forensics and toxicology veterinary |
| InChIKey | FEBLZLNTKCEFIT-VSXGLTOVSA-N |
| SMILES | CC1(C)O[C@@H]2C[C@H]3[C@@H]4C[C@H](F)C5=CC(=O)C=C[C@]5(C)[C@@]4(F)[C@@H](O)C[C@]3(C)[C@@]2(O1)C(=O)CO |
| CAS DataBase Reference | 67-73-2(CAS DataBase Reference) |
| EPA Substance Registry System | Fluocinolone acetonide (67-73-2) |
Description and Uses
A synthetic glucocorticoid VEGF inhibitor; anti-inflammatory.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40-20/21/22 |
| Safety Statements | 26-36-22 |
| WGK Germany | 3 |
| RTECS | TU3830000 |
| HS Code | 2937220000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 67-73-2(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: > 4gm/kg |







