A4367412
2'Fucosyllactose (2'FL) , ≥95% , 41263-94-9
Synonym(s):
2′-Ο-Fucosyllactose;2′-Fucosyllactose
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB399.20 | In Stock |
|
| 5MG | RMB1399.20 | In Stock |
|
| 25mg | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-231 °C (decomp) |
| Boiling point: | 902.2±65.0 °C(Predicted) |
| Density | 1.548 g/cm3 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | H2O: soluble2 mg + 0.2 mL, clear, colorless |
| form | Solid |
| pka | 12.39±0.20(Predicted) |
| color | Off-White to Pale Yellow |
| biological source | milk |
| optical activity | -53.5 → -57.5 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING SKIN PROTECTING |
| InChIKey | HWHQUWQCBPAQQH-AONKQOPENA-N |
| SMILES | O1[C@H]([C@H]([C@@H]([C@@H]([C@@H]1C)O)O)O)O[C@H]2[C@@H](O[C@@H]([C@@H]([C@@H]2O)O)CO)O[C@@H]([C@H](O)[C@@H](O)C=O)[C@H](O)CO |
Description and Uses
2'-Focusllactose is also known as 2'-FL. It is one of the main oligosaccharides found in human milk [1]. 2'-FL is often added to the Infant Formula. Supplementation of 2'-FL in biological infancy has a pre-biotic and intestinal trophic effect and can promotes immune system[2].
2''-Fucosyllactose - Synthetic (cas# 41263-94-9) is a human milk sugar oligosaccharide used in infant nutritian products.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | B |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |






