A4368912
Fenoxaprop-p-ethyl , 95% , 71283-80-2
Synonym(s):
Ethyl (R)-2-{4-[(6-chlorobenzoxazol-2-yl)oxy]phenoxy}propionate;Fenoxaprop-P-ethyl
| Pack Size | Price | Stock | Quantity |
| 1G | RMB183.20 | In Stock |
|
| 5G | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-84°C (lit.) |
| Boiling point: | >300 °C |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥ 100 mg/mL (276.41 mM) |
| pka | -0.08±0.30(Predicted) |
| form | Solid |
| color | White to off-white |
| optical activity | [α]20/D +29°, c = 1 in chloroform |
| Water Solubility | 705.4ug/L(temperature not stated) |
| BRN | 8158010 |
| Major Application | agriculture environmental |
| InChI | 1S/C18H16ClNO5/c1-3-22-17(21)11(2)23-13-5-7-14(8-6-13)24-18-20-15-9-4-12(19)10-16(15)25-18/h4-11H,3H2,1-2H3/t11-/m1/s1 |
| InChIKey | PQKBPHSEKWERTG-LLVKDONJSA-N |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc(Oc2nc3ccc(Cl)cc3o2)cc1 |
| CAS DataBase Reference | 71283-80-2(CAS DataBase Reference) |
| EPA Substance Registry System | Fenoxaprop-P-ethyl (71283-80-2) |
Description and Uses
Postemergent herbicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H373-H410 |
| Precautionary statements | P260-P272-P273-P280-P302+P352-P314 |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 STOT RE 2 |
| Toxicity | LD50 in male, female rats (mg/kg): 3040, 2090 orally; >2000, >2000 dermally (Huff) |







