A4372612
Fmoc-L-β-phenylalanine , 95% , 220498-02-2
Synonym(s):
(R)-3-(Fmoc-amino)-3-phenylpropionic acid;Fmoc-L -β-phenylalanine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB147.20 | In Stock |
|
| 1G | RMB468.80 | In Stock |
|
| 5G | RMB1545.84 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181.7 °C |
| Boiling point: | 513.39°C (rough estimate) |
| Density | 1.2379 (rough estimate) |
| refractive index | 1.5614 (estimate) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 4.27±0.10(Predicted) |
| color | White to off-white |
| BRN | 7982022 |
| Major Application | peptide synthesis |
| InChI | 1S/C24H21NO4/c26-23(27)14-22(16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27)/t22-/m1/s1 |
| InChIKey | PTSLRPMRTOVHAB-JOCHJYFZSA-N |
| SMILES | OC(=O)C[C@@H](NC(=O)OCC1c2ccccc2-c3ccccc13)c4ccccc4 |
| CAS DataBase Reference | 220498-02-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |
