A4375312
2-Fluoropyridine-4-boronic acid pinacol ester , 95% , 458532-86-0
CAS NO.：458532-86-0
Empirical Formula: C11H15BFNO2
Molecular Weight: 223.05
MDL number: MFCD06798253
| Pack Size | Price | Stock | Quantity |
| 1G | RMB130.40 | In Stock |
|
| 5G | RMB1290.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-52℃ |
| Boiling point: | 312.1±27.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystals or Powder |
| pka | -1.27±0.10(Predicted) |
| color | Yellow to beige |
| InChI | 1S/C11H15BFNO2/c1-10(2)11(3,4)16-12(15-10)8-5-6-14-9(13)7-8/h5-7H,1-4H3 |
| InChIKey | PCLMNCBIXQQRMB-UHFFFAOYSA-N |
| SMILES | FC1=NC=CC(B(OC(C)2C)OC2(C)C)=C1 |
Description and Uses
Used in pharmaceuticals, agrochemicals, and high-tech materials.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P301+P310+P330-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| RIDADR | 2811 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
