A4376012
3-Fluorobenzenesulfonyl chloride , ≥98.0%(GC) , 701-27-9
CAS NO.:701-27-9
Empirical Formula: C6H4ClFO2S
Molecular Weight: 194.61
MDL number: MFCD00042286
EINECS: 628-370-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB91.20 | In Stock |
|
| 25G | RMB356.00 | In Stock |
|
| 100g | RMB848.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7°C |
| Boiling point: | 231-232 °C (lit.) |
| Density | 1.463 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Powder, Granules or Chunks |
| color | Grey-brown to dark brown |
| Sensitive | Moisture Sensitive |
| BRN | 2091631 |
| InChI | InChI=1S/C6H4ClFO2S/c7-11(9,10)6-3-1-2-5(8)4-6/h1-4H |
| InChIKey | OKYSUJVCDXZGKE-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=CC(F)=C1 |
| CAS DataBase Reference | 701-27-9(CAS DataBase Reference) |
Description and Uses
3-Fluorobenzenesulfonyl chloride may be used in the preparation of 1-(2-bromobenzyl)-2-(3-fluorophenyl)pyrrole and 1-(2-bromobenzyl)-2,5-bis(3-fluorophenyl)pyrrole.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xi |
| Risk Statements | 34-29-14-36/37/38 |
| Safety Statements | 26-36/37/39-45-8-30-23-27 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







