BD0466732
2,5-Difluorobenzene-1-sulfonyl chloride , 97% , 26120-86-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB32.00 | In Stock |
|
| 10g | RMB51.20 | In Stock |
|
| 25g | RMB120.00 | In Stock |
|
| 100g | RMB472.00 | In Stock |
|
| 500g | RMB2327.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 221 °C (lit.) |
| Density | 1.58 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | liquid |
| color | Clear, yellow/green |
| Sensitive | Moisture Sensitive |
| BRN | 2723886 |
| InChI | 1S/C6H3ClF2O2S/c7-12(10,11)6-3-4(8)1-2-5(6)9/h1-3H |
| InChIKey | CELLJWUVMKEJDY-UHFFFAOYSA-N |
| SMILES | Fc1ccc(F)c(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 26120-86-5(CAS DataBase Reference) |
Description and Uses
2,5-Difluorobenzenesulfonyl chloride participates in the synthesis of aryl sulfonamide-based mineralocorticoid receptor (MR) antagonists.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






