A4378612
3-Fluoro-2-nitroaniline , 98% , 567-63-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB135.20 | In Stock |
|
| 25g | RMB490.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 305.7±22.0 °C(Predicted) |
| Density | 1.448 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | crystalline solid |
| pka | -1.24±0.10(Predicted) |
| color | Dark red |
| InChI | InChI=1S/C6H5FN2O2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H,8H2 |
| InChIKey | NSFGNLQLWFZHKK-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(F)=C1[N+]([O-])=O |
| CAS DataBase Reference | 567-63-5 |
Description and Uses
3-Fluoro-2-nitroaniline is a useful research chemical used in the preparation of benzylamines and quinoxaline-diones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 2811 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2921420090 |






