PRODUCT Properties
| Boiling point: | 215°C(lit.) |
| Density | 1.075±0.06 g/cm3(Predicted) |
| refractive index | 1.5128 |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C9H9FO/c1-6-5-8(7(2)11)3-4-9(6)10/h3-5H,1-2H3 |
| InChIKey | SMSVMBMJEYTUOZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(F)C(C)=C1)C |
| CAS DataBase Reference | 369-32-4 |
Description and Uses
4'-Fluoro-3'-methylacetophenone is used as pharmaceutical intermediate, and an intermediate in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P280g-P305+P351+P338-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2914790090 |
